C18H20O4 — CID 163104113
(8aR,10aR)-2,3-dimethoxy-8a-methyl-5-methylidene-6,9,10,10a-tetrahydroanthracene-1,4-dione (PubChem CID 163104113) has the molecular formula C18H20O4 and a molecular weight of 300.35 g/mol. Its IUPAC name is (8aR,10aR)-2,3-dimethoxy-8a-methyl-5-methylidene-6,9,10,10a-tetrahydroanthracene-1,4-dione.
| Compound Name | (8aR,10aR)-2,3-dimethoxy-8a-methyl-5-methylidene-6,9,10,10a-tetrahydroanthracene-1,4-dione |
|---|---|
| PubChem CID | 163104113 |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | (8aR,10aR)-2,3-dimethoxy-8a-methyl-5-methylidene-6,9,10,10a-tetrahydroanthracene-1,4-dione |
| SMILES | C=C1CC=C[C@@]2(C)CC3=C(C[C@H]12)C(=O)C(OC)=C(OC)C3=O |
| InChI | InChI=1S/C18H20O4/c1-10-6-5-7-18(2)9-12-11(8-13(10)18)14(19)16(21-3)17(22-4)15(12)20/h5,7,13H,1,6,8-9H2,2-4H3/t13-,18+/m1/s1 |
| InChIKey | GFWSTYAKNHELSQ-ACJLOTCBSA-N |
| XLogP | 2.87 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|