C21H38O4 — CID 163104149
(2E,7S,10E,12R)-3,7-bis(hydroxymethyl)-11,15-dimethyl-14-methylidenehexadeca-2,10-diene-1,12-diol (PubChem CID 163104149) has the molecular formula C21H38O4 and a molecular weight of 354.53 g/mol. Its IUPAC name is (2E,7S,10E,12R)-3,7-bis(hydroxymethyl)-11,15-dimethyl-14-methylidenehexadeca-2,10-diene-1,12-diol.
| Compound Name | (2E,7S,10E,12R)-3,7-bis(hydroxymethyl)-11,15-dimethyl-14-methylidenehexadeca-2,10-diene-1,12-diol |
|---|---|
| PubChem CID | 163104149 |
| Molecular Formula | C21H38O4 |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.28 |
| IUPAC Name | (2E,7S,10E,12R)-3,7-bis(hydroxymethyl)-11,15-dimethyl-14-methylidenehexadeca-2,10-diene-1,12-diol |
| SMILES | C=C(C[C@@H](O)/C(C)=C/CC[C@@H](CO)CCC/C(=C\CO)CO)C(C)C |
| InChI | InChI=1S/C21H38O4/c1-16(2)18(4)13-21(25)17(3)7-5-8-19(14-23)9-6-10-20(15-24)11-12-22/h7,11,16,19,21-25H,4-6,8-10,12-15H2,1-3H3/b17-7+,20-11+/t19-,21-/m1/s1 |
| InChIKey | GNDMMQFAFXCKOZ-RXHBZMGCSA-N |
| XLogP | 3.37 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|