C15H24O3 — CID 163104310
(3aS,5R,9S,9aS)-2,2,5-trimethyl-4-oxo-3,3a,5,6,7,8,9,9a-octahydro-1H-cyclopenta[8]annulene-9-carboxylic acid (PubChem CID 163104310) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is (3aS,5R,9S,9aS)-2,2,5-trimethyl-4-oxo-3,3a,5,6,7,8,9,9a-octahydro-1H-cyclopenta[8]annulene-9-carboxylic acid.
| Compound Name | (3aS,5R,9S,9aS)-2,2,5-trimethyl-4-oxo-3,3a,5,6,7,8,9,9a-octahydro-1H-cyclopenta[8]annulene-9-carboxylic acid |
|---|---|
| PubChem CID | 163104310 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (3aS,5R,9S,9aS)-2,2,5-trimethyl-4-oxo-3,3a,5,6,7,8,9,9a-octahydro-1H-cyclopenta[8]annulene-9-carboxylic acid |
| SMILES | C[C@@H]1CCC[C@H](C(=O)O)[C@H]2CC(C)(C)C[C@@H]2C1=O |
| InChI | InChI=1S/C15H24O3/c1-9-5-4-6-10(14(17)18)11-7-15(2,3)8-12(11)13(9)16/h9-12H,4-8H2,1-3H3,(H,17,18)/t9-,10+,11-,12+/m1/s1 |
| InChIKey | HOHCDSFOXYGYNB-KXNHARMFSA-N |
| XLogP | 3.13 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |