C16H28O5 — CID 163104804
(2R,3S,4S,5S)-2-[(3E,5S)-5-hydroxy-4,8-dimethylnona-3,7-dienyl]oxane-3,4,5-triol (PubChem CID 163104804) has the molecular formula C16H28O5 and a molecular weight of 300.39 g/mol. Its IUPAC name is (2R,3S,4S,5S)-2-[(3E,5S)-5-hydroxy-4,8-dimethylnona-3,7-dienyl]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5S)-2-[(3E,5S)-5-hydroxy-4,8-dimethylnona-3,7-dienyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 163104804 |
| Molecular Formula | C16H28O5 |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | (2R,3S,4S,5S)-2-[(3E,5S)-5-hydroxy-4,8-dimethylnona-3,7-dienyl]oxane-3,4,5-triol |
| SMILES | CC(C)=CC[C@H](O)/C(C)=C/CC[C@H]1OC[C@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H28O5/c1-10(2)7-8-12(17)11(3)5-4-6-14-16(20)15(19)13(18)9-21-14/h5,7,12-20H,4,6,8-9H2,1-3H3/b11-5+/t12-,13-,14+,15-,16+/m0/s1 |
| InChIKey | KVQNAYKJHQZVPK-VCYHANCMSA-N |
| XLogP | 0.91 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|