C24H26O10 — CID 163104895
[(1S,2S,6S,7S,8R,12S,14S)-8-acetyloxy-9,14-dimethyl-5-methylidene-4,11-dioxo-3,13-dioxatetracyclo[8.4.0.02,6.012,14]tetradec-9-en-7-yl] (E)-2-(acetyloxymethyl)but-2-enoate (PubChem CID 163104895) has the molecular formula C24H26O10 and a molecular weight of 474.46 g/mol. Its IUPAC name is [(1S,2S,6S,7S,8R,12S,14S)-8-acetyloxy-9,14-dimethyl-5-methylidene-4,11-dioxo-3,13-dioxatetracyclo[8.4.0.02,6.012,14]tetradec-9-en-7-yl] (E)-2-(acetyloxymethyl)but-2-enoate.
| Compound Name | [(1S,2S,6S,7S,8R,12S,14S)-8-acetyloxy-9,14-dimethyl-5-methylidene-4,11-dioxo-3,13-dioxatetracyclo[8.4.0.02,6.012,14]tetradec-9-en-7-yl] (E)-2-(acetyloxymethyl)but-2-enoate |
|---|---|
| PubChem CID | 163104895 |
| Molecular Formula | C24H26O10 |
| Molecular Weight | 474.46 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | [(1S,2S,6S,7S,8R,12S,14S)-8-acetyloxy-9,14-dimethyl-5-methylidene-4,11-dioxo-3,13-dioxatetracyclo[8.4.0.02,6.012,14]tetradec-9-en-7-yl] (E)-2-(acetyloxymethyl)but-2-enoate |
| SMILES | C=C1C(=O)O[C@H]2[C@H]1[C@H](OC(=O)/C(=C/C)COC(C)=O)[C@H](OC(C)=O)C(C)=C1C(=O)[C@H]3O[C@@]3(C)[C@@H]12 |
| InChI | InChI=1S/C24H26O10/c1-7-13(8-30-11(4)25)23(29)33-20-15-10(3)22(28)32-19(15)16-14(9(2)18(20)31-12(5)26)17(27)21-24(16,6)34-21/h7,15-16,18-21H,3,8H2,1-2,4-6H3/b13-7+/t15-,16-,18+,19-,20-,21+,24-/m0/s1 |
| InChIKey | LLKVQNOYDMSENS-BMGAQZPTSA-N |
| XLogP | 1.12 |
| TPSA | 134.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.46 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|