C18H28N2O — CID 163105439
N-[(1R,4S,6R,8R,9R)-4-methyl-13-azatetracyclo[7.7.0.01,6.02,13]hexadec-2-en-8-yl]acetamide (PubChem CID 163105439) has the molecular formula C18H28N2O and a molecular weight of 288.43 g/mol. Its IUPAC name is N-[(1R,4S,6R,8R,9R)-4-methyl-13-azatetracyclo[7.7.0.01,6.02,13]hexadec-2-en-8-yl]acetamide.
| Compound Name | N-[(1R,4S,6R,8R,9R)-4-methyl-13-azatetracyclo[7.7.0.01,6.02,13]hexadec-2-en-8-yl]acetamide |
|---|---|
| PubChem CID | 163105439 |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | N-[(1R,4S,6R,8R,9R)-4-methyl-13-azatetracyclo[7.7.0.01,6.02,13]hexadec-2-en-8-yl]acetamide |
| SMILES | CC(=O)N[C@@H]1C[C@H]2C[C@H](C)C=C3N4CCC[C@@H]1[C@]32CCC4 |
| InChI | InChI=1S/C18H28N2O/c1-12-9-14-11-16(19-13(2)21)15-5-3-7-20-8-4-6-18(14,15)17(20)10-12/h10,12,14-16H,3-9,11H2,1-2H3,(H,19,21)/t12-,14+,15-,16+,18+/m0/s1 |
| InChIKey | OUOOYDSFWFBZIG-RFUJCOMKSA-N |
| XLogP | 2.93 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |