C8H13N5O — CID 163105540
7,9-dimethyl-2-(methylamino)-1,8-dihydropurin-6-one (PubChem CID 163105540) has the molecular formula C8H13N5O and a molecular weight of 195.23 g/mol. Its IUPAC name is 7,9-dimethyl-2-(methylamino)-1,8-dihydropurin-6-one.
| Compound Name | 7,9-dimethyl-2-(methylamino)-1,8-dihydropurin-6-one |
|---|---|
| PubChem CID | 163105540 |
| Molecular Formula | C8H13N5O |
| Molecular Weight | 195.23 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | 7,9-dimethyl-2-(methylamino)-1,8-dihydropurin-6-one |
| SMILES | CNc1nc2c(c(=O)[nH]1)N(C)CN2C |
| InChI | InChI=1S/C8H13N5O/c1-9-8-10-6-5(7(14)11-8)12(2)4-13(6)3/h4H2,1-3H3,(H2,9,10,11,14) |
| InChIKey | PNAKOPAZUOVNMB-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 64.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.23 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |