C15H20O4 — CID 163105851
(1R,8R,9R,10S,11S,12S)-9,10-dihydroxy-14,14-dimethyl-6-oxatetracyclo[9.2.1.04,12.08,12]tetradec-3-en-5-one (PubChem CID 163105851) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is (1R,8R,9R,10S,11S,12S)-9,10-dihydroxy-14,14-dimethyl-6-oxatetracyclo[9.2.1.04,12.08,12]tetradec-3-en-5-one.
| Compound Name | (1R,8R,9R,10S,11S,12S)-9,10-dihydroxy-14,14-dimethyl-6-oxatetracyclo[9.2.1.04,12.08,12]tetradec-3-en-5-one |
|---|---|
| PubChem CID | 163105851 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | (1R,8R,9R,10S,11S,12S)-9,10-dihydroxy-14,14-dimethyl-6-oxatetracyclo[9.2.1.04,12.08,12]tetradec-3-en-5-one |
| SMILES | CC1(C)[C@@H]2CC=C3C(=O)OC[C@@H]4[C@@H](O)[C@@H](O)[C@@H]1[C@]34C2 |
| InChI | InChI=1S/C15H20O4/c1-14(2)7-3-4-8-13(18)19-6-9-10(16)11(17)12(14)15(8,9)5-7/h4,7,9-12,16-17H,3,5-6H2,1-2H3/t7-,9-,10-,11-,12+,15-/m1/s1 |
| InChIKey | RPENBJGKZCCIDL-PWEOXZDBSA-N |
| XLogP | 0.87 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |