C12H20O7 — CID 163106159
(2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-[(1R,4R)-4-hydroxy-1-methylcyclopent-2-en-1-yl]oxyoxane-3,4,5-triol (PubChem CID 163106159) has the molecular formula C12H20O7 and a molecular weight of 276.29 g/mol. Its IUPAC name is (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-[(1R,4R)-4-hydroxy-1-methylcyclopent-2-en-1-yl]oxyoxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-[(1R,4R)-4-hydroxy-1-methylcyclopent-2-en-1-yl]oxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 163106159 |
| Molecular Formula | C12H20O7 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-[(1R,4R)-4-hydroxy-1-methylcyclopent-2-en-1-yl]oxyoxane-3,4,5-triol |
| SMILES | C[C@]1(O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)C=C[C@H](O)C1 |
| InChI | InChI=1S/C12H20O7/c1-12(3-2-6(14)4-12)19-11-10(17)9(16)8(15)7(5-13)18-11/h2-3,6-11,13-17H,4-5H2,1H3/t6-,7+,8-,9-,10+,11-,12-/m0/s1 |
| InChIKey | UFZWDZHJFRAKDR-MQOZHFKUSA-N |
| XLogP | -2.12 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|