About 2-(dimethylamino)-7,9-dimethyl-1,8-dihydropurin-6-one
2-(dimethylamino)-7,9-dimethyl-1,8-dihydropurin-6-one (PubChem CID 163106187) has the molecular formula C9H15N5O
and a molecular weight of 209.25 g/mol. Its IUPAC name is 2-(dimethylamino)-7,9-dimethyl-1,8-dihydropurin-6-one.
Molecular Properties
| Compound Name | 2-(dimethylamino)-7,9-dimethyl-1,8-dihydropurin-6-one |
| PubChem CID | 163106187 |
| Molecular Formula | C9H15N5O |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | 2-(dimethylamino)-7,9-dimethyl-1,8-dihydropurin-6-one |
| SMILES | CN(C)c1nc2c(c(=O)[nH]1)N(C)CN2C |
| InChI | InChI=1S/C9H15N5O/c1-12(2)9-10-7-6(8(15)11-9)13(3)5-14(7)4/h5H2,1-4H3,(H,10,11,15) |
| InChIKey | UMTVZFRPWXBUBE-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 55.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(dimethylamino)-7,9-dimethyl-1,8-dihydropurin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)-7,9-dimethyl-1,8-dihydropurin-6-one?
The IUPAC name of 2-(dimethylamino)-7,9-dimethyl-1,8-dihydropurin-6-one (CID 163106187) is 2-(dimethylamino)-7,9-dimethyl-1,8-dihydropurin-6-one.
What is the SMILES notation for 2-(dimethylamino)-7,9-dimethyl-1,8-dihydropurin-6-one?
The canonical SMILES for 2-(dimethylamino)-7,9-dimethyl-1,8-dihydropurin-6-one is CN(C)c1nc2c(c(=O)[nH]1)N(C)CN2C.
What is the InChIKey of 2-(dimethylamino)-7,9-dimethyl-1,8-dihydropurin-6-one?
The InChIKey is UMTVZFRPWXBUBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N5O/c1-12(2)9-10-7-6(8(15)11-9)13(3)5-14(7)4/h5H2,1-4H3,(H,10,11,15).
What are the key properties of 2-(dimethylamino)-7,9-dimethyl-1,8-dihydropurin-6-one?
2-(dimethylamino)-7,9-dimethyl-1,8-dihydropurin-6-one has a molecular weight of 209.25 g/mol, XLogP of -0.32, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)-7,9-dimethyl-1,8-dihydropurin-6-one is sourced from PubChem (CID 163106187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).