C15H26 — CID 163106339
(3S,5S,6R)-6,10-dimethyl-3-propan-2-ylspiro[4.5]dec-9-ene (PubChem CID 163106339) has the molecular formula C15H26 and a molecular weight of 206.37 g/mol. Its IUPAC name is (3S,5S,6R)-6,10-dimethyl-3-propan-2-ylspiro[4.5]dec-9-ene.
| Compound Name | (3S,5S,6R)-6,10-dimethyl-3-propan-2-ylspiro[4.5]dec-9-ene |
|---|---|
| PubChem CID | 163106339 |
| Molecular Formula | C15H26 |
| Molecular Weight | 206.37 g/mol |
| Exact Mass | 206.20 |
| IUPAC Name | (3S,5S,6R)-6,10-dimethyl-3-propan-2-ylspiro[4.5]dec-9-ene |
| SMILES | CC1=CCC[C@@H](C)[C@@]12CC[C@H](C(C)C)C2 |
| InChI | InChI=1S/C15H26/c1-11(2)14-8-9-15(10-14)12(3)6-5-7-13(15)4/h6,11,13-14H,5,7-10H2,1-4H3/t13-,14+,15-/m1/s1 |
| InChIKey | VRDGFDINTZFVNN-QLFBSQMISA-N |
| XLogP | 4.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.37 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|