C20H38O3 — CID 163106468
(2S,7R)-7-methyl-3-methylidene-10-[(2R)-2,6,6-trimethyloxan-2-yl]decane-1,2-diol (PubChem CID 163106468) has the molecular formula C20H38O3 and a molecular weight of 326.52 g/mol. Its IUPAC name is (2S,7R)-7-methyl-3-methylidene-10-[(2R)-2,6,6-trimethyloxan-2-yl]decane-1,2-diol.
| Compound Name | (2S,7R)-7-methyl-3-methylidene-10-[(2R)-2,6,6-trimethyloxan-2-yl]decane-1,2-diol |
|---|---|
| PubChem CID | 163106468 |
| Molecular Formula | C20H38O3 |
| Molecular Weight | 326.52 g/mol |
| Exact Mass | 326.28 |
| IUPAC Name | (2S,7R)-7-methyl-3-methylidene-10-[(2R)-2,6,6-trimethyloxan-2-yl]decane-1,2-diol |
| SMILES | C=C(CCC[C@@H](C)CCC[C@]1(C)CCCC(C)(C)O1)[C@H](O)CO |
| InChI | InChI=1S/C20H38O3/c1-16(9-6-11-17(2)18(22)15-21)10-7-13-20(5)14-8-12-19(3,4)23-20/h16,18,21-22H,2,6-15H2,1,3-5H3/t16-,18-,20-/m1/s1 |
| InChIKey | WSHXZEKFCZOCJL-YVWKXTFCSA-N |
| XLogP | 4.61 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.52 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|