C23H33NO4 — CID 163107080
(1S,6R,9E,11S,14S,15R,16S)-6-hydroxy-13,14-dimethyl-16-(2-methylpropyl)-17-azatricyclo[9.7.0.01,15]octadeca-9,12-diene-2,5,18-trione (PubChem CID 163107080) has the molecular formula C23H33NO4 and a molecular weight of 387.52 g/mol. Its IUPAC name is (1S,6R,9E,11S,14S,15R,16S)-6-hydroxy-13,14-dimethyl-16-(2-methylpropyl)-17-azatricyclo[9.7.0.01,15]octadeca-9,12-diene-2,5,18-trione.
| Compound Name | (1S,6R,9E,11S,14S,15R,16S)-6-hydroxy-13,14-dimethyl-16-(2-methylpropyl)-17-azatricyclo[9.7.0.01,15]octadeca-9,12-diene-2,5,18-trione |
|---|---|
| PubChem CID | 163107080 |
| Molecular Formula | C23H33NO4 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.24 |
| IUPAC Name | (1S,6R,9E,11S,14S,15R,16S)-6-hydroxy-13,14-dimethyl-16-(2-methylpropyl)-17-azatricyclo[9.7.0.01,15]octadeca-9,12-diene-2,5,18-trione |
| SMILES | CC1=C[C@@H]2/C=C/CC[C@@H](O)C(=O)CCC(=O)[C@]23C(=O)N[C@@H](CC(C)C)[C@@H]3[C@@H]1C |
| InChI | InChI=1S/C23H33NO4/c1-13(2)11-17-21-15(4)14(3)12-16-7-5-6-8-18(25)19(26)9-10-20(27)23(16,21)22(28)24-17/h5,7,12-13,15-18,21,25H,6,8-11H2,1-4H3,(H,24,28)/b7-5+/t15-,16+,17+,18-,21+,23-/m1/s1 |
| InChIKey | AEWVHSHRWIXYAA-QTVAXVMYSA-N |
| XLogP | 2.97 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|