C20H24O7 — CID 163107194
methyl 5-methyl-4-[(3-methyl-7,11-dioxo-2,6-dioxatetracyclo[6.3.1.03,10.05,9]dodecan-12-yl)methyl]-2-oxohex-5-enoate (PubChem CID 163107194) has the molecular formula C20H24O7 and a molecular weight of 376.41 g/mol. Its IUPAC name is methyl 5-methyl-4-[(3-methyl-7,11-dioxo-2,6-dioxatetracyclo[6.3.1.03,10.05,9]dodecan-12-yl)methyl]-2-oxohex-5-enoate.
| Compound Name | methyl 5-methyl-4-[(3-methyl-7,11-dioxo-2,6-dioxatetracyclo[6.3.1.03,10.05,9]dodecan-12-yl)methyl]-2-oxohex-5-enoate |
|---|---|
| PubChem CID | 163107194 |
| Molecular Formula | C20H24O7 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | methyl 5-methyl-4-[(3-methyl-7,11-dioxo-2,6-dioxatetracyclo[6.3.1.03,10.05,9]dodecan-12-yl)methyl]-2-oxohex-5-enoate |
| SMILES | C=C(C)C(CC(=O)C(=O)OC)CC1C2OC3(C)CC4OC(=O)C1C4C3C2=O |
| InChI | InChI=1S/C20H24O7/c1-8(2)9(6-11(21)18(23)25-4)5-10-13-14-12(26-19(13)24)7-20(3)15(14)16(22)17(10)27-20/h9-10,12-15,17H,1,5-7H2,2-4H3 |
| InChIKey | AMVUHBHKJZZENZ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|