C16H22O4 — CID 163107396
(3E,5R,6E,9E,13S)-5-hydroxy-5,9,13-trimethyl-1-oxacyclotetradeca-3,6,9-triene-2,8-dione (PubChem CID 163107396) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is (3E,5R,6E,9E,13S)-5-hydroxy-5,9,13-trimethyl-1-oxacyclotetradeca-3,6,9-triene-2,8-dione.
| Compound Name | (3E,5R,6E,9E,13S)-5-hydroxy-5,9,13-trimethyl-1-oxacyclotetradeca-3,6,9-triene-2,8-dione |
|---|---|
| PubChem CID | 163107396 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | (3E,5R,6E,9E,13S)-5-hydroxy-5,9,13-trimethyl-1-oxacyclotetradeca-3,6,9-triene-2,8-dione |
| SMILES | C/C1=C\CC[C@H](C)COC(=O)/C=C/[C@](C)(O)/C=C/C1=O |
| InChI | InChI=1S/C16H22O4/c1-12-5-4-6-13(2)14(17)7-9-16(3,19)10-8-15(18)20-11-12/h6-10,12,19H,4-5,11H2,1-3H3/b9-7+,10-8+,13-6+/t12-,16+/m0/s1 |
| InChIKey | BCZGASPHWCSCEP-ACACXYQQSA-N |
| XLogP | 2.34 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |