C28H42O6 — CID 163107474
[9-(hydroxymethyl)-5,9,13-trimethyl-22-oxo-21,24-dioxahexacyclo[16.5.1.01,20.04,17.05,14.08,13]tetracosan-2-yl] acetate (PubChem CID 163107474) has the molecular formula C28H42O6 and a molecular weight of 474.64 g/mol. Its IUPAC name is [9-(hydroxymethyl)-5,9,13-trimethyl-22-oxo-21,24-dioxahexacyclo[16.5.1.01,20.04,17.05,14.08,13]tetracosan-2-yl] acetate.
| Compound Name | [9-(hydroxymethyl)-5,9,13-trimethyl-22-oxo-21,24-dioxahexacyclo[16.5.1.01,20.04,17.05,14.08,13]tetracosan-2-yl] acetate |
|---|---|
| PubChem CID | 163107474 |
| Molecular Formula | C28H42O6 |
| Molecular Weight | 474.64 g/mol |
| Exact Mass | 474.30 |
| IUPAC Name | [9-(hydroxymethyl)-5,9,13-trimethyl-22-oxo-21,24-dioxahexacyclo[16.5.1.01,20.04,17.05,14.08,13]tetracosan-2-yl] acetate |
| SMILES | CC(=O)OC1CC2C(CCC3C2(C)CCC2C(C)(CO)CCCC23C)C2CC3OC(=O)CC13O2 |
| InChI | InChI=1S/C28H42O6/c1-16(30)32-22-12-18-17(19-13-23-28(22,34-19)14-24(31)33-23)6-7-21-26(18,3)11-8-20-25(2,15-29)9-5-10-27(20,21)4/h17-23,29H,5-15H2,1-4H3 |
| InChIKey | BIEGPDCQAUHIKP-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.64 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |