C33H60O11 — CID 163108317
2-(4,5-dihydroxy-3-methoxyoxan-2-yl)oxy-4a,7-dimethyl-7-(1,2,9-trihydroxy-4,8-dimethylnonan-3-yl)-2,3,4,4b,5,6,8,9,10,10a-decahydro-1H-phenanthrene-8a,9,10-triol (PubChem CID 163108317) has the molecular formula C33H60O11 and a molecular weight of 632.83 g/mol. Its IUPAC name is 2-(4,5-dihydroxy-3-methoxyoxan-2-yl)oxy-4a,7-dimethyl-7-(1,2,9-trihydroxy-4,8-dimethylnonan-3-yl)-2,3,4,4b,5,6,8,9,10,10a-decahydro-1H-phenanthrene-8a,9,10-triol.
| Compound Name | 2-(4,5-dihydroxy-3-methoxyoxan-2-yl)oxy-4a,7-dimethyl-7-(1,2,9-trihydroxy-4,8-dimethylnonan-3-yl)-2,3,4,4b,5,6,8,9,10,10a-decahydro-1H-phenanthrene-8a,9,10-triol |
|---|---|
| PubChem CID | 163108317 |
| Molecular Formula | C33H60O11 |
| Molecular Weight | 632.83 g/mol |
| Exact Mass | 632.41 |
| IUPAC Name | 2-(4,5-dihydroxy-3-methoxyoxan-2-yl)oxy-4a,7-dimethyl-7-(1,2,9-trihydroxy-4,8-dimethylnonan-3-yl)-2,3,4,4b,5,6,8,9,10,10a-decahydro-1H-phenanthrene-8a,9,10-triol |
| SMILES | COC1C(OC2CCC3(C)C(C2)C(O)C(O)C2(O)CC(C)(C(C(C)CCCC(C)CO)C(O)CO)CCC32)OCC(O)C1O |
| InChI | InChI=1S/C33H60O11/c1-18(14-34)7-6-8-19(2)25(22(36)15-35)31(3)11-10-24-32(4)12-9-20(13-21(32)26(38)29(40)33(24,41)17-31)44-30-28(42-5)27(39)23(37)16-43-30/h18-30,34-41H,6-17H2,1-5H3 |
| InChIKey | DOPKUHGHEPTQGX-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 189.53 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.83 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'saponine_derivative', 'substructure': 'N/A'} |
|---|