C19H28O6 — CID 163108831
[3-[6-(acetyloxymethyl)-2-hydroxy-2-methyl-4a,5,6,7,8,8a-hexahydro-1H-naphthalen-1-yl]-3-oxopropyl] acetate (PubChem CID 163108831) has the molecular formula C19H28O6 and a molecular weight of 352.43 g/mol. Its IUPAC name is [3-[6-(acetyloxymethyl)-2-hydroxy-2-methyl-4a,5,6,7,8,8a-hexahydro-1H-naphthalen-1-yl]-3-oxopropyl] acetate.
| Compound Name | [3-[6-(acetyloxymethyl)-2-hydroxy-2-methyl-4a,5,6,7,8,8a-hexahydro-1H-naphthalen-1-yl]-3-oxopropyl] acetate |
|---|---|
| PubChem CID | 163108831 |
| Molecular Formula | C19H28O6 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | [3-[6-(acetyloxymethyl)-2-hydroxy-2-methyl-4a,5,6,7,8,8a-hexahydro-1H-naphthalen-1-yl]-3-oxopropyl] acetate |
| SMILES | CC(=O)OCCC(=O)C1C2CCC(COC(C)=O)CC2C=CC1(C)O |
| InChI | InChI=1S/C19H28O6/c1-12(20)24-9-7-17(22)18-16-5-4-14(11-25-13(2)21)10-15(16)6-8-19(18,3)23/h6,8,14-16,18,23H,4-5,7,9-11H2,1-3H3 |
| InChIKey | FYDYUINNZWREDS-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|