C22H32O — CID 163108996
(3R,5R,8E,13E,15S)-5,9,13,18-tetramethyl-17-methylidene-4-oxatricyclo[13.3.0.03,5]octadeca-1(18),8,13-triene (PubChem CID 163108996) has the molecular formula C22H32O and a molecular weight of 312.50 g/mol. Its IUPAC name is (3R,5R,8E,13E,15S)-5,9,13,18-tetramethyl-17-methylidene-4-oxatricyclo[13.3.0.03,5]octadeca-1(18),8,13-triene.
| Compound Name | (3R,5R,8E,13E,15S)-5,9,13,18-tetramethyl-17-methylidene-4-oxatricyclo[13.3.0.03,5]octadeca-1(18),8,13-triene |
|---|---|
| PubChem CID | 163108996 |
| Molecular Formula | C22H32O |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | (3R,5R,8E,13E,15S)-5,9,13,18-tetramethyl-17-methylidene-4-oxatricyclo[13.3.0.03,5]octadeca-1(18),8,13-triene |
| SMILES | C=C1C[C@H]2/C=C(\C)CCC/C(C)=C/CC[C@@]3(C)O[C@@H]3CC2=C1C |
| InChI | InChI=1S/C22H32O/c1-15-8-6-9-16(2)12-19-13-17(3)18(4)20(19)14-21-22(5,23-21)11-7-10-15/h10,12,19,21H,3,6-9,11,13-14H2,1-2,4-5H3/b15-10+,16-12+/t19-,21-,22-/m1/s1 |
| InChIKey | GKVRPEUJOMORMB-ATQWNMQFSA-N |
| XLogP | 6.28 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|