About Sarcophytolide
Sarcophytolide (PubChem CID 163108996) has the molecular formula C22H32O
and a molecular weight of 312.50 g/mol. Its IUPAC name is (3R,5R,8E,13E,15S)-5,9,13,18-tetramethyl-17-methylidene-4-oxatricyclo[13.3.0.03,5]octadeca-1(18),8,13-triene.
Molecular Properties
| Compound Name | Sarcophytolide |
| PubChem CID | 163108996 |
| Molecular Formula | C22H32O |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | (3R,5R,8E,13E,15S)-5,9,13,18-tetramethyl-17-methylidene-4-oxatricyclo[13.3.0.03,5]octadeca-1(18),8,13-triene |
| SMILES | C/C/1=C\CC[C@@]2([C@H](O2)CC3=C(C(=C)C[C@H]3/C=C(/CCC1)\C)C)C |
| InChI | InChI=1S/C22H32O/c1-15-8-6-9-16(2)12-19-13-17(3)18(4)20(19)14-21-22(5,23-21)11-7-10-15/h10,12,19,21H,3,6-9,11,13-14H2,1-2,4-5H3/b15-10+,16-12+/t19-,21-,22-/m1/s1 |
| InChIKey | GKVRPEUJOMORMB-ATQWNMQFSA-N |
| XLogP | 4.20 |
| TPSA | 12.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | 589 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze Sarcophytolide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Sarcophytolide?
The IUPAC name of Sarcophytolide (CID 163108996) is (3R,5R,8E,13E,15S)-5,9,13,18-tetramethyl-17-methylidene-4-oxatricyclo[13.3.0.03,5]octadeca-1(18),8,13-triene.
What is the SMILES notation for Sarcophytolide?
The canonical SMILES for Sarcophytolide is C/C/1=C\CC[C@@]2([C@H](O2)CC3=C(C(=C)C[C@H]3/C=C(/CCC1)\C)C)C.
What is the InChIKey of Sarcophytolide?
The InChIKey is GKVRPEUJOMORMB-ATQWNMQFSA-N. The full InChI is InChI=1S/C22H32O/c1-15-8-6-9-16(2)12-19-13-17(3)18(4)20(19)14-21-22(5,23-21)11-7-10-15/h10,12,19,21H,3,6-9,11,13-14H2,1-2,4-5H3/b15-10+,16-12+/t19-,21-,22-/m1/s1.
What are the key properties of Sarcophytolide?
Sarcophytolide has a molecular weight of 312.50 g/mol, XLogP of 4.20, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Sarcophytolide is sourced from PubChem (CID 163108996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).