C11H18N2O4 — CID 163109468
3-[(2S,5S)-5-[(2S)-butan-2-yl]-3,6-dioxopiperazin-2-yl]propanoic acid (PubChem CID 163109468) has the molecular formula C11H18N2O4 and a molecular weight of 242.27 g/mol. Its IUPAC name is 3-[(2S,5S)-5-[(2S)-butan-2-yl]-3,6-dioxopiperazin-2-yl]propanoic acid.
| Compound Name | 3-[(2S,5S)-5-[(2S)-butan-2-yl]-3,6-dioxopiperazin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 163109468 |
| Molecular Formula | C11H18N2O4 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 3-[(2S,5S)-5-[(2S)-butan-2-yl]-3,6-dioxopiperazin-2-yl]propanoic acid |
| SMILES | CC[C@H](C)[C@@H]1NC(=O)[C@H](CCC(=O)O)NC1=O |
| InChI | InChI=1S/C11H18N2O4/c1-3-6(2)9-11(17)12-7(10(16)13-9)4-5-8(14)15/h6-7,9H,3-5H2,1-2H3,(H,12,17)(H,13,16)(H,14,15)/t6-,7-,9-/m0/s1 |
| InChIKey | HUNKOLLSBWNBAS-ZKWXMUAHSA-N |
| XLogP | -0.12 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |