C16H26O4 — CID 163109469
3a-(hydroxymethyl)-3-methoxy-6,8a,8b-trimethyl-1,2,3,4a,7,8-hexahydrocyclopenta[b][1]benzofuran-1-ol (PubChem CID 163109469) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is 3a-(hydroxymethyl)-3-methoxy-6,8a,8b-trimethyl-1,2,3,4a,7,8-hexahydrocyclopenta[b][1]benzofuran-1-ol.
| Compound Name | 3a-(hydroxymethyl)-3-methoxy-6,8a,8b-trimethyl-1,2,3,4a,7,8-hexahydrocyclopenta[b][1]benzofuran-1-ol |
|---|---|
| PubChem CID | 163109469 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 3a-(hydroxymethyl)-3-methoxy-6,8a,8b-trimethyl-1,2,3,4a,7,8-hexahydrocyclopenta[b][1]benzofuran-1-ol |
| SMILES | COC1CC(O)C2(C)C3(C)CCC(C)=CC3OC12CO |
| InChI | InChI=1S/C16H26O4/c1-10-5-6-14(2)12(7-10)20-16(9-17)13(19-4)8-11(18)15(14,16)3/h7,11-13,17-18H,5-6,8-9H2,1-4H3 |
| InChIKey | HUOIYUNHZSQGOK-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|