C26H42O6 — CID 163109588
(1S,2R,3E,7S,9R,11R,14E,16S,19R)-18,19-dihydroxy-2,4,9,16,19-pentamethyl-9-propyl-8,12,21-trioxatricyclo[16.2.1.07,11]henicosa-3,14-dien-13-one (PubChem CID 163109588) has the molecular formula C26H42O6 and a molecular weight of 450.62 g/mol. Its IUPAC name is (1S,2R,3E,7S,9R,11R,14E,16S,19R)-18,19-dihydroxy-2,4,9,16,19-pentamethyl-9-propyl-8,12,21-trioxatricyclo[16.2.1.07,11]henicosa-3,14-dien-13-one.
| Compound Name | (1S,2R,3E,7S,9R,11R,14E,16S,19R)-18,19-dihydroxy-2,4,9,16,19-pentamethyl-9-propyl-8,12,21-trioxatricyclo[16.2.1.07,11]henicosa-3,14-dien-13-one |
|---|---|
| PubChem CID | 163109588 |
| Molecular Formula | C26H42O6 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.30 |
| IUPAC Name | (1S,2R,3E,7S,9R,11R,14E,16S,19R)-18,19-dihydroxy-2,4,9,16,19-pentamethyl-9-propyl-8,12,21-trioxatricyclo[16.2.1.07,11]henicosa-3,14-dien-13-one |
| SMILES | CCC[C@]1(C)C[C@H]2OC(=O)/C=C/[C@@H](C)CC3(O)O[C@@H](C[C@@]3(C)O)[C@H](C)/C=C(\C)CC[C@@H]2O1 |
| InChI | InChI=1S/C26H42O6/c1-7-12-24(5)15-22-20(31-24)10-8-17(2)13-19(4)21-16-25(6,28)26(29,32-21)14-18(3)9-11-23(27)30-22/h9,11,13,18-22,28-29H,7-8,10,12,14-16H2,1-6H3/b11-9+,17-13+/t18-,19-,20+,21+,22-,24-,25-,26?/m1/s1 |
| InChIKey | IBRCZGAOFWCQNI-KMNLGFTPSA-N |
| XLogP | 4.43 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|