C15H18BrClO2 — CID 163110004
(3R,4R,6Z,8Z)-9-(1-bromopropyl)-4-chloro-3-[(Z)-pent-2-en-4-ynyl]-4,5-dihydro-3H-dioxonine (PubChem CID 163110004) has the molecular formula C15H18BrClO2 and a molecular weight of 345.66 g/mol. Its IUPAC name is (3R,4R,6Z,8Z)-9-(1-bromopropyl)-4-chloro-3-[(Z)-pent-2-en-4-ynyl]-4,5-dihydro-3H-dioxonine.
| Compound Name | (3R,4R,6Z,8Z)-9-(1-bromopropyl)-4-chloro-3-[(Z)-pent-2-en-4-ynyl]-4,5-dihydro-3H-dioxonine |
|---|---|
| PubChem CID | 163110004 |
| Molecular Formula | C15H18BrClO2 |
| Molecular Weight | 345.66 g/mol |
| Exact Mass | 344.02 |
| IUPAC Name | (3R,4R,6Z,8Z)-9-(1-bromopropyl)-4-chloro-3-[(Z)-pent-2-en-4-ynyl]-4,5-dihydro-3H-dioxonine |
| SMILES | C#C/C=C\C[C@H]1OO/C(C(Br)CC)=C\C=C/C[C@H]1Cl |
| InChI | InChI=1S/C15H18BrClO2/c1-3-5-6-11-15-13(17)9-7-8-10-14(18-19-15)12(16)4-2/h1,5-8,10,12-13,15H,4,9,11H2,2H3/b6-5-,8-7-,14-10-/t12?,13-,15-/m1/s1 |
| InChIKey | JEGPDVKNFYNXOP-IZFDYKRZSA-N |
| XLogP | 4.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.66 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|