C26H27N3O4 — CID 163110112
10',10'-dimethyl-7-prop-1-en-2-ylspiro[1H-furo[2,3-g]indole-3,11'-3,13-diazatetracyclo[5.5.2.01,9.03,7]tetradecane]-2,2',14'-trione (PubChem CID 163110112) has the molecular formula C26H27N3O4 and a molecular weight of 445.52 g/mol. Its IUPAC name is 10',10'-dimethyl-7-prop-1-en-2-ylspiro[1H-furo[2,3-g]indole-3,11'-3,13-diazatetracyclo[5.5.2.01,9.03,7]tetradecane]-2,2',14'-trione.
| Compound Name | 10',10'-dimethyl-7-prop-1-en-2-ylspiro[1H-furo[2,3-g]indole-3,11'-3,13-diazatetracyclo[5.5.2.01,9.03,7]tetradecane]-2,2',14'-trione |
|---|---|
| PubChem CID | 163110112 |
| Molecular Formula | C26H27N3O4 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 10',10'-dimethyl-7-prop-1-en-2-ylspiro[1H-furo[2,3-g]indole-3,11'-3,13-diazatetracyclo[5.5.2.01,9.03,7]tetradecane]-2,2',14'-trione |
| SMILES | C=C(C)c1cc2c3c(ccc2o1)C1(CC24NC(=O)C5(CCCN5C2=O)CC4C1(C)C)C(=O)N3 |
| InChI | InChI=1S/C26H27N3O4/c1-13(2)17-10-14-16(33-17)7-6-15-19(14)27-21(31)25(15)12-26-18(23(25,3)4)11-24(20(30)28-26)8-5-9-29(24)22(26)32/h6-7,10,18H,1,5,8-9,11-12H2,2-4H3,(H,27,31)(H,28,30) |
| InChIKey | JLNGNQBRPFMFRS-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |