C15H22Br2 — CID 163110438
(4R,6S)-4,10-dibromo-1,5,5,9-tetramethylspiro[5.5]undeca-1,9-diene (PubChem CID 163110438) has the molecular formula C15H22Br2 and a molecular weight of 362.15 g/mol. Its IUPAC name is (4R,6S)-4,10-dibromo-1,5,5,9-tetramethylspiro[5.5]undeca-1,9-diene.
| Compound Name | (4R,6S)-4,10-dibromo-1,5,5,9-tetramethylspiro[5.5]undeca-1,9-diene |
|---|---|
| PubChem CID | 163110438 |
| Molecular Formula | C15H22Br2 |
| Molecular Weight | 362.15 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | (4R,6S)-4,10-dibromo-1,5,5,9-tetramethylspiro[5.5]undeca-1,9-diene |
| SMILES | CC1=CC[C@@H](Br)C(C)(C)[C@]12CCC(C)=C(Br)C2 |
| InChI | InChI=1S/C15H22Br2/c1-10-7-8-15(9-12(10)16)11(2)5-6-13(17)14(15,3)4/h5,13H,6-9H2,1-4H3/t13-,15+/m1/s1 |
| InChIKey | KITUCYHXYPLPSR-HIFRSBDPSA-N |
| XLogP | 5.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.15 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|