C27H38O3 — CID 163110720
(1S,2S,4aR,4bS,8aS,10aR)-2,4b,7',8,8,10a-hexamethylspiro[2,3,4,4a,5,6,7,8a,9,10-decahydrophenanthrene-1,2'-3H-1-benzofuran]-4',5'-dione (PubChem CID 163110720) has the molecular formula C27H38O3 and a molecular weight of 410.60 g/mol. Its IUPAC name is (1S,2S,4aR,4bS,8aS,10aR)-2,4b,7',8,8,10a-hexamethylspiro[2,3,4,4a,5,6,7,8a,9,10-decahydrophenanthrene-1,2'-3H-1-benzofuran]-4',5'-dione.
| Compound Name | (1S,2S,4aR,4bS,8aS,10aR)-2,4b,7',8,8,10a-hexamethylspiro[2,3,4,4a,5,6,7,8a,9,10-decahydrophenanthrene-1,2'-3H-1-benzofuran]-4',5'-dione |
|---|---|
| PubChem CID | 163110720 |
| Molecular Formula | C27H38O3 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.28 |
| IUPAC Name | (1S,2S,4aR,4bS,8aS,10aR)-2,4b,7',8,8,10a-hexamethylspiro[2,3,4,4a,5,6,7,8a,9,10-decahydrophenanthrene-1,2'-3H-1-benzofuran]-4',5'-dione |
| SMILES | CC1=CC(=O)C(=O)C2=C1O[C@@]1(C2)[C@@H](C)CC[C@@H]2[C@@]3(C)CCCC(C)(C)[C@@H]3CC[C@]21C |
| InChI | InChI=1S/C27H38O3/c1-16-14-19(28)22(29)18-15-27(30-23(16)18)17(2)8-9-21-25(5)12-7-11-24(3,4)20(25)10-13-26(21,27)6/h14,17,20-21H,7-13,15H2,1-6H3/t17-,20-,21+,25-,26+,27-/m0/s1 |
| InChIKey | LEDSCTGHBKLLJP-XBCOVPHVSA-N |
| XLogP | 6.18 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|