C11H16BrCl3O2 — CID 163111128
[(1S,2S,4R,5R)-5-bromo-2,4-dichloro-5-(chloromethyl)-1-methylcyclohexyl]methyl acetate (PubChem CID 163111128) has the molecular formula C11H16BrCl3O2 and a molecular weight of 366.51 g/mol. Its IUPAC name is [(1S,2S,4R,5R)-5-bromo-2,4-dichloro-5-(chloromethyl)-1-methylcyclohexyl]methyl acetate.
| Compound Name | [(1S,2S,4R,5R)-5-bromo-2,4-dichloro-5-(chloromethyl)-1-methylcyclohexyl]methyl acetate |
|---|---|
| PubChem CID | 163111128 |
| Molecular Formula | C11H16BrCl3O2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 363.94 |
| IUPAC Name | [(1S,2S,4R,5R)-5-bromo-2,4-dichloro-5-(chloromethyl)-1-methylcyclohexyl]methyl acetate |
| SMILES | CC(=O)OC[C@]1(C)C[C@@](Br)(CCl)[C@H](Cl)C[C@@H]1Cl |
| InChI | InChI=1S/C11H16BrCl3O2/c1-7(16)17-6-10(2)4-11(12,5-13)9(15)3-8(10)14/h8-9H,3-6H2,1-2H3/t8-,9+,10-,11+/m0/s1 |
| InChIKey | MHQSTQDPTAQKDO-ZRUFSTJUSA-N |
| XLogP | 3.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|