C15H17BrO — CID 163111208
(1R,3aS,8bS)-7-bromo-1,2,6,8b-tetramethyl-1,3a-dihydrocyclopenta[b][1]benzofuran (PubChem CID 163111208) has the molecular formula C15H17BrO and a molecular weight of 293.20 g/mol. Its IUPAC name is (1R,3aS,8bS)-7-bromo-1,2,6,8b-tetramethyl-1,3a-dihydrocyclopenta[b][1]benzofuran.
| Compound Name | (1R,3aS,8bS)-7-bromo-1,2,6,8b-tetramethyl-1,3a-dihydrocyclopenta[b][1]benzofuran |
|---|---|
| PubChem CID | 163111208 |
| Molecular Formula | C15H17BrO |
| Molecular Weight | 293.20 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | (1R,3aS,8bS)-7-bromo-1,2,6,8b-tetramethyl-1,3a-dihydrocyclopenta[b][1]benzofuran |
| SMILES | CC1=C[C@@H]2Oc3cc(C)c(Br)cc3[C@]2(C)[C@@H]1C |
| InChI | InChI=1S/C15H17BrO/c1-8-6-14-15(4,10(8)3)11-7-12(16)9(2)5-13(11)17-14/h5-7,10,14H,1-4H3/t10-,14+,15+/m1/s1 |
| InChIKey | MMEXGLZIRBXUQE-ONERCXAPSA-N |
| XLogP | 4.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.20 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|