C25H29Cl3O6 — CID 163111675
11,20,21-trichloro-10,15-dihydroxy-6,14,18,18,22-pentamethyl-7,13-dioxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-3,9,11-triene-8,19-dione (PubChem CID 163111675) has the molecular formula C25H29Cl3O6 and a molecular weight of 531.86 g/mol. Its IUPAC name is 11,20,21-trichloro-10,15-dihydroxy-6,14,18,18,22-pentamethyl-7,13-dioxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-3,9,11-triene-8,19-dione.
| Compound Name | 11,20,21-trichloro-10,15-dihydroxy-6,14,18,18,22-pentamethyl-7,13-dioxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-3,9,11-triene-8,19-dione |
|---|---|
| PubChem CID | 163111675 |
| Molecular Formula | C25H29Cl3O6 |
| Molecular Weight | 531.86 g/mol |
| Exact Mass | 530.10 |
| IUPAC Name | 11,20,21-trichloro-10,15-dihydroxy-6,14,18,18,22-pentamethyl-7,13-dioxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-3,9,11-triene-8,19-dione |
| SMILES | CC1Cc2c3c(c(Cl)c(O)c2C(=O)O1)OC1(C)C(O)CC2C(C)(C)C(=O)C(Cl)C(Cl)C2(C)C1C3 |
| InChI | InChI=1S/C25H29Cl3O6/c1-9-6-10-11-7-13-24(4)12(23(2,3)21(31)17(27)20(24)28)8-14(29)25(13,5)34-19(11)16(26)18(30)15(10)22(32)33-9/h9,12-14,17,20,29-30H,6-8H2,1-5H3 |
| InChIKey | NRHSHMGYZPIQPR-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.86 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|