C21H34O3 — CID 163111681
(1S,3aE,6E,9R,10S,10aS)-1-methoxy-7-methyl-10-[(2R)-6-methylhept-5-en-2-yl]-3,5,8,9,10,10a-hexahydro-1H-cyclonona[c]furan-9-ol (PubChem CID 163111681) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is (1S,3aE,6E,9R,10S,10aS)-1-methoxy-7-methyl-10-[(2R)-6-methylhept-5-en-2-yl]-3,5,8,9,10,10a-hexahydro-1H-cyclonona[c]furan-9-ol.
| Compound Name | (1S,3aE,6E,9R,10S,10aS)-1-methoxy-7-methyl-10-[(2R)-6-methylhept-5-en-2-yl]-3,5,8,9,10,10a-hexahydro-1H-cyclonona[c]furan-9-ol |
|---|---|
| PubChem CID | 163111681 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | (1S,3aE,6E,9R,10S,10aS)-1-methoxy-7-methyl-10-[(2R)-6-methylhept-5-en-2-yl]-3,5,8,9,10,10a-hexahydro-1H-cyclonona[c]furan-9-ol |
| SMILES | CO[C@H]1OC/C2=C/C/C=C(\C)C[C@@H](O)[C@@H]([C@H](C)CCC=C(C)C)[C@@H]21 |
| InChI | InChI=1S/C21H34O3/c1-14(2)8-6-10-16(4)19-18(22)12-15(3)9-7-11-17-13-24-21(23-5)20(17)19/h8-9,11,16,18-22H,6-7,10,12-13H2,1-5H3/b15-9+,17-11-/t16-,18-,19-,20-,21+/m1/s1 |
| InChIKey | NRNRQQVQNKEZMS-FWAIOGIVSA-N |
| XLogP | 4.63 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|