C20H30O2 — CID 163111901
(6E,10S,11E,14E,15aS)-3,6,10,14-tetramethyl-4,5,8,9,13,15a-hexahydro-2H-cyclotetradeca[b]furan-10-ol (PubChem CID 163111901) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is (6E,10S,11E,14E,15aS)-3,6,10,14-tetramethyl-4,5,8,9,13,15a-hexahydro-2H-cyclotetradeca[b]furan-10-ol.
| Compound Name | (6E,10S,11E,14E,15aS)-3,6,10,14-tetramethyl-4,5,8,9,13,15a-hexahydro-2H-cyclotetradeca[b]furan-10-ol |
|---|---|
| PubChem CID | 163111901 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | (6E,10S,11E,14E,15aS)-3,6,10,14-tetramethyl-4,5,8,9,13,15a-hexahydro-2H-cyclotetradeca[b]furan-10-ol |
| SMILES | CC1=C2CC/C(C)=C/CC[C@](C)(O)/C=C/C/C(C)=C/[C@@H]2OC1 |
| InChI | InChI=1S/C20H30O2/c1-15-7-5-11-20(4,21)12-6-8-16(2)13-19-18(10-9-15)17(3)14-22-19/h6-7,12-13,19,21H,5,8-11,14H2,1-4H3/b12-6+,15-7+,16-13+/t19-,20-/m0/s1 |
| InChIKey | OJMUCDXLECGABI-JHAOQSPJSA-N |
| XLogP | 4.87 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|