C16H26O5 — CID 163112215
(1-acetyl-4a,5-dihydroxy-8,8a-dimethyl-1,2,3,4,5,6,7,8-octahydronaphthalen-2-yl) acetate (PubChem CID 163112215) has the molecular formula C16H26O5 and a molecular weight of 298.38 g/mol. Its IUPAC name is (1-acetyl-4a,5-dihydroxy-8,8a-dimethyl-1,2,3,4,5,6,7,8-octahydronaphthalen-2-yl) acetate.
| Compound Name | (1-acetyl-4a,5-dihydroxy-8,8a-dimethyl-1,2,3,4,5,6,7,8-octahydronaphthalen-2-yl) acetate |
|---|---|
| PubChem CID | 163112215 |
| Molecular Formula | C16H26O5 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | (1-acetyl-4a,5-dihydroxy-8,8a-dimethyl-1,2,3,4,5,6,7,8-octahydronaphthalen-2-yl) acetate |
| SMILES | CC(=O)OC1CCC2(O)C(O)CCC(C)C2(C)C1C(C)=O |
| InChI | InChI=1S/C16H26O5/c1-9-5-6-13(19)16(20)8-7-12(21-11(3)18)14(10(2)17)15(9,16)4/h9,12-14,19-20H,5-8H2,1-4H3 |
| InChIKey | PGCSMCHPCUTUDH-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |