C24H21N3O4 — CID 163112824
dimethyl 3,4-bis(1H-indol-3-yl)-2,5-dihydro-1H-pyrrole-2,5-dicarboxylate (PubChem CID 163112824) has the molecular formula C24H21N3O4 and a molecular weight of 415.45 g/mol. Its IUPAC name is dimethyl 3,4-bis(1H-indol-3-yl)-2,5-dihydro-1H-pyrrole-2,5-dicarboxylate.
| Compound Name | dimethyl 3,4-bis(1H-indol-3-yl)-2,5-dihydro-1H-pyrrole-2,5-dicarboxylate |
|---|---|
| PubChem CID | 163112824 |
| Molecular Formula | C24H21N3O4 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | dimethyl 3,4-bis(1H-indol-3-yl)-2,5-dihydro-1H-pyrrole-2,5-dicarboxylate |
| SMILES | COC(=O)C1NC(C(=O)OC)C(c2c[nH]c3ccccc23)=C1c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C24H21N3O4/c1-30-23(28)21-19(15-11-25-17-9-5-3-7-13(15)17)20(22(27-21)24(29)31-2)16-12-26-18-10-6-4-8-14(16)18/h3-12,21-22,25-27H,1-2H3 |
| InChIKey | QWKIJIBGAGWNJJ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 96.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |