About (2S)-2-acetamido-3-[(Z,4Z)-4-cyclopenta[b]pyridin-5-ylidenebut-2-en-2-yl]sulfanylpropanoic acid
(2S)-2-acetamido-3-[(Z,4Z)-4-cyclopenta[b]pyridin-5-ylidenebut-2-en-2-yl]sulfanylpropanoic acid (PubChem CID 163112956) has the molecular formula C17H18N2O3S
and a molecular weight of 330.41 g/mol. Its IUPAC name is (2S)-2-acetamido-3-[(Z,4Z)-4-cyclopenta[b]pyridin-5-ylidenebut-2-en-2-yl]sulfanylpropanoic acid.
Molecular Properties
| Compound Name | (2S)-2-acetamido-3-[(Z,4Z)-4-cyclopenta[b]pyridin-5-ylidenebut-2-en-2-yl]sulfanylpropanoic acid |
| PubChem CID | 163112956 |
| Molecular Formula | C17H18N2O3S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | (2S)-2-acetamido-3-[(Z,4Z)-4-cyclopenta[b]pyridin-5-ylidenebut-2-en-2-yl]sulfanylpropanoic acid |
| SMILES | CC(=O)N[C@H](CS/C(C)=C\C=C1\C=Cc2ncccc21)C(=O)O |
| InChI | InChI=1S/C17H18N2O3S/c1-11(23-10-16(17(21)22)19-12(2)20)5-6-13-7-8-15-14(13)4-3-9-18-15/h3-9,16H,10H2,1-2H3,(H,19,20)(H,21,22)/b11-5-,13-6-/t16-/m1/s1 |
| InChIKey | RDOAILCTQUQNDX-WIKCEIQHSA-N |
| XLogP | 2.72 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-2-acetamido-3-[(Z,4Z)-4-cyclopenta[b]pyridin-5-ylidenebut-2-en-2-yl]sulfanylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-acetamido-3-[(Z,4Z)-4-cyclopenta[b]pyridin-5-ylidenebut-2-en-2-yl]sulfanylpropanoic acid?
The IUPAC name of (2S)-2-acetamido-3-[(Z,4Z)-4-cyclopenta[b]pyridin-5-ylidenebut-2-en-2-yl]sulfanylpropanoic acid (CID 163112956) is (2S)-2-acetamido-3-[(Z,4Z)-4-cyclopenta[b]pyridin-5-ylidenebut-2-en-2-yl]sulfanylpropanoic acid.
What is the SMILES notation for (2S)-2-acetamido-3-[(Z,4Z)-4-cyclopenta[b]pyridin-5-ylidenebut-2-en-2-yl]sulfanylpropanoic acid?
The canonical SMILES for (2S)-2-acetamido-3-[(Z,4Z)-4-cyclopenta[b]pyridin-5-ylidenebut-2-en-2-yl]sulfanylpropanoic acid is CC(=O)N[C@H](CS/C(C)=C\C=C1\C=Cc2ncccc21)C(=O)O.
What is the InChIKey of (2S)-2-acetamido-3-[(Z,4Z)-4-cyclopenta[b]pyridin-5-ylidenebut-2-en-2-yl]sulfanylpropanoic acid?
The InChIKey is RDOAILCTQUQNDX-WIKCEIQHSA-N. The full InChI is InChI=1S/C17H18N2O3S/c1-11(23-10-16(17(21)22)19-12(2)20)5-6-13-7-8-15-14(13)4-3-9-18-15/h3-9,16H,10H2,1-2H3,(H,19,20)(H,21,22)/b11-5-,13-6-/t16-/m1/s1.
What are the key properties of (2S)-2-acetamido-3-[(Z,4Z)-4-cyclopenta[b]pyridin-5-ylidenebut-2-en-2-yl]sulfanylpropanoic acid?
(2S)-2-acetamido-3-[(Z,4Z)-4-cyclopenta[b]pyridin-5-ylidenebut-2-en-2-yl]sulfanylpropanoic acid has a molecular weight of 330.41 g/mol, XLogP of 2.72, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-acetamido-3-[(Z,4Z)-4-cyclopenta[b]pyridin-5-ylidenebut-2-en-2-yl]sulfanylpropanoic acid is sourced from PubChem (CID 163112956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).