C21H34O7 — CID 163113023
2-[(6,8a,8b-trimethyl-1,2,3,4a,7,8-hexahydrocyclopenta[b][1]benzofuran-3a-yl)methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 163113023) has the molecular formula C21H34O7 and a molecular weight of 398.50 g/mol. Its IUPAC name is 2-[(6,8a,8b-trimethyl-1,2,3,4a,7,8-hexahydrocyclopenta[b][1]benzofuran-3a-yl)methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | 2-[(6,8a,8b-trimethyl-1,2,3,4a,7,8-hexahydrocyclopenta[b][1]benzofuran-3a-yl)methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 163113023 |
| Molecular Formula | C21H34O7 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | 2-[(6,8a,8b-trimethyl-1,2,3,4a,7,8-hexahydrocyclopenta[b][1]benzofuran-3a-yl)methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CC1=CC2OC3(COC4OC(CO)C(O)C(O)C4O)CCCC3(C)C2(C)CC1 |
| InChI | InChI=1S/C21H34O7/c1-12-5-8-19(2)14(9-12)28-21(7-4-6-20(19,21)3)11-26-18-17(25)16(24)15(23)13(10-22)27-18/h9,13-18,22-25H,4-8,10-11H2,1-3H3 |
| InChIKey | RHSWUVSQGOLHGB-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|