C18H18Cl2O4 — CID 163113029
9-(2,6-dichloro-3,5-dihydroxyphenyl)-3,5-dimethyldeca-2,4,6,8-tetraenoic acid (PubChem CID 163113029) has the molecular formula C18H18Cl2O4 and a molecular weight of 369.24 g/mol. Its IUPAC name is 9-(2,6-dichloro-3,5-dihydroxyphenyl)-3,5-dimethyldeca-2,4,6,8-tetraenoic acid.
| Compound Name | 9-(2,6-dichloro-3,5-dihydroxyphenyl)-3,5-dimethyldeca-2,4,6,8-tetraenoic acid |
|---|---|
| PubChem CID | 163113029 |
| Molecular Formula | C18H18Cl2O4 |
| Molecular Weight | 369.24 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | 9-(2,6-dichloro-3,5-dihydroxyphenyl)-3,5-dimethyldeca-2,4,6,8-tetraenoic acid |
| SMILES | CC(=CC(=O)O)C=C(C)C=CC=C(C)c1c(Cl)c(O)cc(O)c1Cl |
| InChI | InChI=1S/C18H18Cl2O4/c1-10(7-11(2)8-15(23)24)5-4-6-12(3)16-17(19)13(21)9-14(22)18(16)20/h4-9,21-22H,1-3H3,(H,23,24) |
| InChIKey | RIEOALOJHFKURR-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.24 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|