C27H42O4 — CID 163113265
(13-hydroxy-5b,8,8,11a,13a-pentamethyl-1,3,5,5a,6,7,7a,9,10,11,11b,12,13,13b-tetradecahydrophenanthro[1,2-g][2]benzofuran-1-yl) acetate (PubChem CID 163113265) has the molecular formula C27H42O4 and a molecular weight of 430.63 g/mol. Its IUPAC name is (13-hydroxy-5b,8,8,11a,13a-pentamethyl-1,3,5,5a,6,7,7a,9,10,11,11b,12,13,13b-tetradecahydrophenanthro[1,2-g][2]benzofuran-1-yl) acetate.
| Compound Name | (13-hydroxy-5b,8,8,11a,13a-pentamethyl-1,3,5,5a,6,7,7a,9,10,11,11b,12,13,13b-tetradecahydrophenanthro[1,2-g][2]benzofuran-1-yl) acetate |
|---|---|
| PubChem CID | 163113265 |
| Molecular Formula | C27H42O4 |
| Molecular Weight | 430.63 g/mol |
| Exact Mass | 430.31 |
| IUPAC Name | (13-hydroxy-5b,8,8,11a,13a-pentamethyl-1,3,5,5a,6,7,7a,9,10,11,11b,12,13,13b-tetradecahydrophenanthro[1,2-g][2]benzofuran-1-yl) acetate |
| SMILES | CC(=O)OC1OCC2=CCC3C4(C)CCC5C(C)(C)CCCC5(C)C4CC(O)C3(C)C21 |
| InChI | InChI=1S/C27H42O4/c1-16(28)31-23-22-17(15-30-23)8-9-19-26(5)13-10-18-24(2,3)11-7-12-25(18,4)20(26)14-21(29)27(19,22)6/h8,18-23,29H,7,9-15H2,1-6H3 |
| InChIKey | RVUXJHGODMAPSO-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.63 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|