C14H18BrClO2 — CID 163113378
(1R,3R,5E,6S,7S,9R)-5-(1-bromopropylidene)-9-[(Z,1R)-1-chlorobut-2-enyl]-4,8-dioxatricyclo[4.2.1.03,7]nonane (PubChem CID 163113378) has the molecular formula C14H18BrClO2 and a molecular weight of 333.65 g/mol. Its IUPAC name is (1R,3R,5E,6S,7S,9R)-5-(1-bromopropylidene)-9-[(Z,1R)-1-chlorobut-2-enyl]-4,8-dioxatricyclo[4.2.1.03,7]nonane.
| Compound Name | (1R,3R,5E,6S,7S,9R)-5-(1-bromopropylidene)-9-[(Z,1R)-1-chlorobut-2-enyl]-4,8-dioxatricyclo[4.2.1.03,7]nonane |
|---|---|
| PubChem CID | 163113378 |
| Molecular Formula | C14H18BrClO2 |
| Molecular Weight | 333.65 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | (1R,3R,5E,6S,7S,9R)-5-(1-bromopropylidene)-9-[(Z,1R)-1-chlorobut-2-enyl]-4,8-dioxatricyclo[4.2.1.03,7]nonane |
| SMILES | C/C=C\[C@@H](Cl)[C@@H]1[C@@H]2/C(=C(\Br)CC)O[C@@H]3C[C@H]1O[C@@H]23 |
| InChI | InChI=1S/C14H18BrClO2/c1-3-5-8(16)11-9-6-10-14(17-9)12(11)13(18-10)7(15)4-2/h3,5,8-12,14H,4,6H2,1-2H3/b5-3-,13-7+/t8-,9-,10-,11+,12-,14-/m1/s1 |
| InChIKey | SBSVPNZWKLHPCR-SDPDORGCSA-N |
| XLogP | 3.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.65 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|