C32H54O7 — CID 163113458
(2R,9R,12S)-9,12-dihydroxy-2-[(2S,5S)-5-(3-methylpent-4-enyl)oxolan-2-yl]-12-[(2R,3R,5R)-3-methyl-5-[(2S,3S)-3-propan-2-yloxiran-2-yl]oxolan-2-yl]dodecane-4,7-dione (PubChem CID 163113458) has the molecular formula C32H54O7 and a molecular weight of 550.78 g/mol. Its IUPAC name is (2R,9R,12S)-9,12-dihydroxy-2-[(2S,5S)-5-(3-methylpent-4-enyl)oxolan-2-yl]-12-[(2R,3R,5R)-3-methyl-5-[(2S,3S)-3-propan-2-yloxiran-2-yl]oxolan-2-yl]dodecane-4,7-dione.
| Compound Name | (2R,9R,12S)-9,12-dihydroxy-2-[(2S,5S)-5-(3-methylpent-4-enyl)oxolan-2-yl]-12-[(2R,3R,5R)-3-methyl-5-[(2S,3S)-3-propan-2-yloxiran-2-yl]oxolan-2-yl]dodecane-4,7-dione |
|---|---|
| PubChem CID | 163113458 |
| Molecular Formula | C32H54O7 |
| Molecular Weight | 550.78 g/mol |
| Exact Mass | 550.39 |
| IUPAC Name | (2R,9R,12S)-9,12-dihydroxy-2-[(2S,5S)-5-(3-methylpent-4-enyl)oxolan-2-yl]-12-[(2R,3R,5R)-3-methyl-5-[(2S,3S)-3-propan-2-yloxiran-2-yl]oxolan-2-yl]dodecane-4,7-dione |
| SMILES | C=CC(C)CC[C@H]1CC[C@@H]([C@H](C)CC(=O)CCC(=O)C[C@H](O)CC[C@H](O)[C@@H]2O[C@@H]([C@@H]3O[C@H]3C(C)C)C[C@H]2C)O1 |
| InChI | InChI=1S/C32H54O7/c1-7-20(4)8-12-26-13-15-28(37-26)21(5)16-23(33)9-10-24(34)18-25(35)11-14-27(36)31-22(6)17-29(38-31)32-30(39-32)19(2)3/h7,19-22,25-32,35-36H,1,8-18H2,2-6H3/t20?,21-,22-,25-,26+,27+,28+,29-,30+,31-,32+/m1/s1 |
| InChIKey | SGPOZQKTJPATMV-DOFRRRJWSA-N |
| XLogP | 5.19 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.78 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|