C20H32O2 — CID 163113530
(3aR,9E,12R,12aS)-1-(2-hydroxypropan-2-yl)-3a,10-dimethyl-6-methylidene-3,4,5,7,8,11,12,12a-octahydrocyclopenta[11]annulen-12-ol (PubChem CID 163113530) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is (3aR,9E,12R,12aS)-1-(2-hydroxypropan-2-yl)-3a,10-dimethyl-6-methylidene-3,4,5,7,8,11,12,12a-octahydrocyclopenta[11]annulen-12-ol.
| Compound Name | (3aR,9E,12R,12aS)-1-(2-hydroxypropan-2-yl)-3a,10-dimethyl-6-methylidene-3,4,5,7,8,11,12,12a-octahydrocyclopenta[11]annulen-12-ol |
|---|---|
| PubChem CID | 163113530 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (3aR,9E,12R,12aS)-1-(2-hydroxypropan-2-yl)-3a,10-dimethyl-6-methylidene-3,4,5,7,8,11,12,12a-octahydrocyclopenta[11]annulen-12-ol |
| SMILES | C=C1CC/C=C(\C)C[C@@H](O)[C@@H]2C(C(C)(C)O)=CC[C@@]2(C)CC1 |
| InChI | InChI=1S/C20H32O2/c1-14-7-6-8-15(2)13-17(21)18-16(19(3,4)22)10-12-20(18,5)11-9-14/h8,10,17-18,21-22H,1,6-7,9,11-13H2,2-5H3/b15-8+/t17-,18+,20-/m1/s1 |
| InChIKey | SMJGGEBBGUMUQC-PLLMSKFTSA-N |
| XLogP | 4.54 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|