C32H52O5 — CID 163113938
10-hydroxy-11-(2-hydroxyethoxy)-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid (PubChem CID 163113938) has the molecular formula C32H52O5 and a molecular weight of 516.76 g/mol. Its IUPAC name is 10-hydroxy-11-(2-hydroxyethoxy)-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid.
| Compound Name | 10-hydroxy-11-(2-hydroxyethoxy)-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid |
|---|---|
| PubChem CID | 163113938 |
| Molecular Formula | C32H52O5 |
| Molecular Weight | 516.76 g/mol |
| Exact Mass | 516.38 |
| IUPAC Name | 10-hydroxy-11-(2-hydroxyethoxy)-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid |
| SMILES | CC1(C)CCC2(C(=O)O)CCC3(C)C(=CCC4C5(C)CC(OCCO)C(O)C(C)(C)C5CCC43C)C2C1 |
| InChI | InChI=1S/C32H52O5/c1-27(2)12-14-32(26(35)36)15-13-30(6)20(21(32)18-27)8-9-24-29(5)19-22(37-17-16-33)25(34)28(3,4)23(29)10-11-31(24,30)7/h8,21-25,33-34H,9-19H2,1-7H3,(H,35,36) |
| InChIKey | UGWNQYZYJNZARC-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.76 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|