C16H22O4 — CID 163113959
(1aR,3S,3aR,4R,6aS,6bS)-4-methoxy-3',4,6b-trimethylspiro[1a,2,3a,5,6,6a-hexahydroindeno[4,5-b]oxirene-3,5'-furan]-2'-one (PubChem CID 163113959) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is (1aR,3S,3aR,4R,6aS,6bS)-4-methoxy-3',4,6b-trimethylspiro[1a,2,3a,5,6,6a-hexahydroindeno[4,5-b]oxirene-3,5'-furan]-2'-one.
| Compound Name | (1aR,3S,3aR,4R,6aS,6bS)-4-methoxy-3',4,6b-trimethylspiro[1a,2,3a,5,6,6a-hexahydroindeno[4,5-b]oxirene-3,5'-furan]-2'-one |
|---|---|
| PubChem CID | 163113959 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | (1aR,3S,3aR,4R,6aS,6bS)-4-methoxy-3',4,6b-trimethylspiro[1a,2,3a,5,6,6a-hexahydroindeno[4,5-b]oxirene-3,5'-furan]-2'-one |
| SMILES | CO[C@]1(C)CC[C@H]2[C@H]1[C@@]1(C=C(C)C(=O)O1)C[C@H]1O[C@]12C |
| InChI | InChI=1S/C16H22O4/c1-9-7-16(20-13(9)17)8-11-15(3,19-11)10-5-6-14(2,18-4)12(10)16/h7,10-12H,5-6,8H2,1-4H3/t10-,11+,12+,14+,15-,16+/m0/s1 |
| InChIKey | UIUDDPLGRFHTPN-GNCRPPFTSA-N |
| XLogP | 2.22 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|