C29H46N2O3S — CID 163114368
2-[(1,2,4a-trimethyl-5-methylidene-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl)methyl]-3-hydroxy-6-(2-methylpropylimino)-4-(3-methylsulfinylpropylamino)cyclohexa-2,4-dien-1-one (PubChem CID 163114368) has the molecular formula C29H46N2O3S and a molecular weight of 502.77 g/mol. Its IUPAC name is 2-[(1,2,4a-trimethyl-5-methylidene-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl)methyl]-3-hydroxy-6-(2-methylpropylimino)-4-(3-methylsulfinylpropylamino)cyclohexa-2,4-dien-1-one.
| Compound Name | 2-[(1,2,4a-trimethyl-5-methylidene-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl)methyl]-3-hydroxy-6-(2-methylpropylimino)-4-(3-methylsulfinylpropylamino)cyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 163114368 |
| Molecular Formula | C29H46N2O3S |
| Molecular Weight | 502.77 g/mol |
| Exact Mass | 502.32 |
| IUPAC Name | 2-[(1,2,4a-trimethyl-5-methylidene-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl)methyl]-3-hydroxy-6-(2-methylpropylimino)-4-(3-methylsulfinylpropylamino)cyclohexa-2,4-dien-1-one |
| SMILES | C=C1CCCC2C1(C)CCC(C)C2(C)CC1=C(O)C(NCCCS(C)=O)=C/C(=N\CC(C)C)C1=O |
| InChI | InChI=1S/C29H46N2O3S/c1-19(2)18-31-24-16-23(30-14-9-15-35(7)34)26(32)22(27(24)33)17-29(6)21(4)12-13-28(5)20(3)10-8-11-25(28)29/h16,19,21,25,30,32H,3,8-15,17-18H2,1-2,4-7H3/b31-24+ |
| InChIKey | BIWIAPNMZBWEAZ-QFMPWRQOSA-N |
| XLogP | 5.91 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.77 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|