C20H32O5 — CID 163114539
(5S)-5-[(1S,2R)-2-[(2E,6Z)-dodeca-2,6-dienoyl]-1-hydroxycyclopropyl]-5-hydroxypentanoic acid (PubChem CID 163114539) has the molecular formula C20H32O5 and a molecular weight of 352.47 g/mol. Its IUPAC name is (5S)-5-[(1S,2R)-2-[(2E,6Z)-dodeca-2,6-dienoyl]-1-hydroxycyclopropyl]-5-hydroxypentanoic acid.
| Compound Name | (5S)-5-[(1S,2R)-2-[(2E,6Z)-dodeca-2,6-dienoyl]-1-hydroxycyclopropyl]-5-hydroxypentanoic acid |
|---|---|
| PubChem CID | 163114539 |
| Molecular Formula | C20H32O5 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | (5S)-5-[(1S,2R)-2-[(2E,6Z)-dodeca-2,6-dienoyl]-1-hydroxycyclopropyl]-5-hydroxypentanoic acid |
| SMILES | CCCCC/C=C\CC/C=C/C(=O)[C@@H]1C[C@@]1(O)[C@@H](O)CCCC(=O)O |
| InChI | InChI=1S/C20H32O5/c1-2-3-4-5-6-7-8-9-10-12-17(21)16-15-20(16,25)18(22)13-11-14-19(23)24/h6-7,10,12,16,18,22,25H,2-5,8-9,11,13-15H2,1H3,(H,23,24)/b7-6-,12-10+/t16-,18-,20-/m0/s1 |
| InChIKey | VPTLHKQYGVLNAO-DCTIKUNRSA-N |
| XLogP | 3.40 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|