C18H26O3 — CID 163114943
(1S,4aR,4bS,7S,8aS,10aS)-7-hydroxy-4b,7,10a-trimethylspiro[5,6,8,8a,9,10-hexahydro-4aH-phenanthrene-1,2'-oxirane]-2-one (PubChem CID 163114943) has the molecular formula C18H26O3 and a molecular weight of 290.40 g/mol. Its IUPAC name is (1S,4aR,4bS,7S,8aS,10aS)-7-hydroxy-4b,7,10a-trimethylspiro[5,6,8,8a,9,10-hexahydro-4aH-phenanthrene-1,2'-oxirane]-2-one.
| Compound Name | (1S,4aR,4bS,7S,8aS,10aS)-7-hydroxy-4b,7,10a-trimethylspiro[5,6,8,8a,9,10-hexahydro-4aH-phenanthrene-1,2'-oxirane]-2-one |
|---|---|
| PubChem CID | 163114943 |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | (1S,4aR,4bS,7S,8aS,10aS)-7-hydroxy-4b,7,10a-trimethylspiro[5,6,8,8a,9,10-hexahydro-4aH-phenanthrene-1,2'-oxirane]-2-one |
| SMILES | C[C@]1(O)CC[C@@]2(C)[C@@H](CC[C@@]3(C)[C@@H]2C=CC(=O)[C@@]32CO2)C1 |
| InChI | InChI=1S/C18H26O3/c1-15(20)8-9-16(2)12(10-15)6-7-17(3)13(16)4-5-14(19)18(17)11-21-18/h4-5,12-13,20H,6-11H2,1-3H3/t12-,13+,15-,16-,17-,18-/m0/s1 |
| InChIKey | WMLYONJBMQORAI-PYCKYVDESA-N |
| XLogP | 2.87 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|