C22H30O5 — CID 163114961
[(3aR,4R,6E,10E,14S,15aR)-6,10,14-trimethyl-3-methylidene-2,15-dioxo-4,5,8,9,12,13,14,15a-octahydro-3aH-cyclotetradeca[b]furan-4-yl] acetate (PubChem CID 163114961) has the molecular formula C22H30O5 and a molecular weight of 374.48 g/mol. Its IUPAC name is [(3aR,4R,6E,10E,14S,15aR)-6,10,14-trimethyl-3-methylidene-2,15-dioxo-4,5,8,9,12,13,14,15a-octahydro-3aH-cyclotetradeca[b]furan-4-yl] acetate.
| Compound Name | [(3aR,4R,6E,10E,14S,15aR)-6,10,14-trimethyl-3-methylidene-2,15-dioxo-4,5,8,9,12,13,14,15a-octahydro-3aH-cyclotetradeca[b]furan-4-yl] acetate |
|---|---|
| PubChem CID | 163114961 |
| Molecular Formula | C22H30O5 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | [(3aR,4R,6E,10E,14S,15aR)-6,10,14-trimethyl-3-methylidene-2,15-dioxo-4,5,8,9,12,13,14,15a-octahydro-3aH-cyclotetradeca[b]furan-4-yl] acetate |
| SMILES | C=C1C(=O)O[C@H]2C(=O)[C@@H](C)CC/C=C(\C)CC/C=C(\C)C[C@@H](OC(C)=O)[C@@H]12 |
| InChI | InChI=1S/C22H30O5/c1-13-8-6-10-14(2)12-18(26-17(5)23)19-16(4)22(25)27-21(19)20(24)15(3)11-7-9-13/h9-10,15,18-19,21H,4,6-8,11-12H2,1-3,5H3/b13-9+,14-10+/t15-,18+,19+,21+/m0/s1 |
| InChIKey | WNHZRLIAMLEDBY-HMUJESDBSA-N |
| XLogP | 4.08 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|