C19H31NO — CID 163115122
(4R,5S)-5-[(Z)-6-aminohex-2-enyl]-4-[(Z)-oct-2-enyl]cyclopent-2-en-1-one (PubChem CID 163115122) has the molecular formula C19H31NO and a molecular weight of 289.46 g/mol. Its IUPAC name is (4R,5S)-5-[(Z)-6-aminohex-2-enyl]-4-[(Z)-oct-2-enyl]cyclopent-2-en-1-one.
| Compound Name | (4R,5S)-5-[(Z)-6-aminohex-2-enyl]-4-[(Z)-oct-2-enyl]cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 163115122 |
| Molecular Formula | C19H31NO |
| Molecular Weight | 289.46 g/mol |
| Exact Mass | 289.24 |
| IUPAC Name | (4R,5S)-5-[(Z)-6-aminohex-2-enyl]-4-[(Z)-oct-2-enyl]cyclopent-2-en-1-one |
| SMILES | CCCCC/C=C\C[C@@H]1C=CC(=O)[C@H]1C/C=C\CCCN |
| InChI | InChI=1S/C19H31NO/c1-2-3-4-5-6-9-12-17-14-15-19(21)18(17)13-10-7-8-11-16-20/h6-7,9-10,14-15,17-18H,2-5,8,11-13,16,20H2,1H3/b9-6-,10-7-/t17-,18+/m1/s1 |
| InChIKey | WWUHSCMZRGPSAD-KDVAVVJSSA-N |
| XLogP | 4.57 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.46 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|