C33H46O4 — CID 163115186
(3E,7S)-7-acetyloxy-3-[(3E,5E,7E)-6,10-dimethylundeca-3,5,7,9-tetraen-2-ylidene]-3a,6,9a-trimethyl-2-methylidene-1,4,5,5a,7,8,9,9b-octahydrocyclopenta[a]naphthalene-6-carboxylic acid (PubChem CID 163115186) has the molecular formula C33H46O4 and a molecular weight of 506.73 g/mol. Its IUPAC name is (3E,7S)-7-acetyloxy-3-[(3E,5E,7E)-6,10-dimethylundeca-3,5,7,9-tetraen-2-ylidene]-3a,6,9a-trimethyl-2-methylidene-1,4,5,5a,7,8,9,9b-octahydrocyclopenta[a]naphthalene-6-carboxylic acid.
| Compound Name | (3E,7S)-7-acetyloxy-3-[(3E,5E,7E)-6,10-dimethylundeca-3,5,7,9-tetraen-2-ylidene]-3a,6,9a-trimethyl-2-methylidene-1,4,5,5a,7,8,9,9b-octahydrocyclopenta[a]naphthalene-6-carboxylic acid |
|---|---|
| PubChem CID | 163115186 |
| Molecular Formula | C33H46O4 |
| Molecular Weight | 506.73 g/mol |
| Exact Mass | 506.34 |
| IUPAC Name | (3E,7S)-7-acetyloxy-3-[(3E,5E,7E)-6,10-dimethylundeca-3,5,7,9-tetraen-2-ylidene]-3a,6,9a-trimethyl-2-methylidene-1,4,5,5a,7,8,9,9b-octahydrocyclopenta[a]naphthalene-6-carboxylic acid |
| SMILES | C=C1CC2C(C)(CCC3C2(C)CC[C@H](OC(C)=O)C3(C)C(=O)O)/C1=C(C)/C=C/C=C(C)/C=C/C=C(C)C |
| InChI | InChI=1S/C33H46O4/c1-21(2)12-10-13-22(3)14-11-15-23(4)29-24(5)20-27-31(7)19-17-28(37-25(6)34)33(9,30(35)36)26(31)16-18-32(27,29)8/h10-15,26-28H,5,16-20H2,1-4,6-9H3,(H,35,36)/b13-10+,15-11+,22-14+,29-23+/t26?,27?,28-,31?,32?,33?/m0/s1 |
| InChIKey | XBVITYAXSIKQAR-DWAKVMANSA-N |
| XLogP | 8.14 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.73 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|