C25H34N2O9 — CID 163115547
[(2R,3S,7R,8R)-3-[(3-acetamido-2-hydroxybenzoyl)amino]-2-methyl-4,9-dioxo-8-pentyl-1,5-dioxonan-7-yl] propanoate (PubChem CID 163115547) has the molecular formula C25H34N2O9 and a molecular weight of 506.55 g/mol. Its IUPAC name is [(2R,3S,7R,8R)-3-[(3-acetamido-2-hydroxybenzoyl)amino]-2-methyl-4,9-dioxo-8-pentyl-1,5-dioxonan-7-yl] propanoate.
| Compound Name | [(2R,3S,7R,8R)-3-[(3-acetamido-2-hydroxybenzoyl)amino]-2-methyl-4,9-dioxo-8-pentyl-1,5-dioxonan-7-yl] propanoate |
|---|---|
| PubChem CID | 163115547 |
| Molecular Formula | C25H34N2O9 |
| Molecular Weight | 506.55 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | [(2R,3S,7R,8R)-3-[(3-acetamido-2-hydroxybenzoyl)amino]-2-methyl-4,9-dioxo-8-pentyl-1,5-dioxonan-7-yl] propanoate |
| SMILES | CCCCC[C@@H]1C(=O)O[C@H](C)[C@H](NC(=O)c2cccc(NC(C)=O)c2O)C(=O)OC[C@@H]1OC(=O)CC |
| InChI | InChI=1S/C25H34N2O9/c1-5-7-8-10-16-19(36-20(29)6-2)13-34-25(33)21(14(3)35-24(16)32)27-23(31)17-11-9-12-18(22(17)30)26-15(4)28/h9,11-12,14,16,19,21,30H,5-8,10,13H2,1-4H3,(H,26,28)(H,27,31)/t14-,16+,19+,21+/m1/s1 |
| InChIKey | XWFQXLOPEKOAMM-YEXOJATBSA-N |
| XLogP | 2.46 |
| TPSA | 157.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.55 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|