C25H30O7 — CID 163116017
2,10,15-trihydroxy-6,14,18,18,22-pentamethyl-7,13-dioxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-3(12),4(9),10,20-tetraene-8,19-dione (PubChem CID 163116017) has the molecular formula C25H30O7 and a molecular weight of 442.51 g/mol. Its IUPAC name is 2,10,15-trihydroxy-6,14,18,18,22-pentamethyl-7,13-dioxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-3(12),4(9),10,20-tetraene-8,19-dione.
| Compound Name | 2,10,15-trihydroxy-6,14,18,18,22-pentamethyl-7,13-dioxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-3(12),4(9),10,20-tetraene-8,19-dione |
|---|---|
| PubChem CID | 163116017 |
| Molecular Formula | C25H30O7 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 2,10,15-trihydroxy-6,14,18,18,22-pentamethyl-7,13-dioxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-3(12),4(9),10,20-tetraene-8,19-dione |
| SMILES | CC1Cc2c(c(O)cc3c2C(O)C2C4(C)C=CC(=O)C(C)(C)C4CC(O)C2(C)O3)C(=O)O1 |
| InChI | InChI=1S/C25H30O7/c1-11-8-12-18(22(30)31-11)13(26)9-14-19(12)20(29)21-24(4)7-6-16(27)23(2,3)15(24)10-17(28)25(21,5)32-14/h6-7,9,11,15,17,20-21,26,28-29H,8,10H2,1-5H3 |
| InChIKey | YXQWJUBIVWMQKE-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |